C11H9Cl2NO — CID 143542112
N-but-2-ynyl-2,6-dichlorobenzamide (PubChem CID 143542112) has the molecular formula C11H9Cl2NO and a molecular weight of 242.10 g/mol. Its IUPAC name is N-but-2-ynyl-2,6-dichlorobenzamide.
| Compound Name | N-but-2-ynyl-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 143542112 |
| Molecular Formula | C11H9Cl2NO |
| Molecular Weight | 242.10 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | N-but-2-ynyl-2,6-dichlorobenzamide |
| SMILES | CC#CCNC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H9Cl2NO/c1-2-3-7-14-11(15)10-8(12)5-4-6-9(10)13/h4-6H,7H2,1H3,(H,14,15) |
| InChIKey | FOKOASDKMZLGTL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|