C15H17ClN2O — CID 53016160
N-butan-2-yl-8-chloro-2-methylquinoline-4-carboxamide (PubChem CID 53016160) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is N-butan-2-yl-8-chloro-2-methylquinoline-4-carboxamide.
| Compound Name | N-butan-2-yl-8-chloro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 53016160 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-butan-2-yl-8-chloro-2-methylquinoline-4-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(C)nc2c(Cl)cccc12 |
| InChI | InChI=1S/C15H17ClN2O/c1-4-9(2)18-15(19)12-8-10(3)17-14-11(12)6-5-7-13(14)16/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | RNEZSIUHNQXDPR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |