C18H15ClN2O3 — CID 77080512
8-chloro-N-[(2,4-dihydroxyphenyl)methyl]-2-methylquinoline-4-carboxamide (PubChem CID 77080512) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is 8-chloro-N-[(2,4-dihydroxyphenyl)methyl]-2-methylquinoline-4-carboxamide.
| Compound Name | 8-chloro-N-[(2,4-dihydroxyphenyl)methyl]-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 77080512 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 8-chloro-N-[(2,4-dihydroxyphenyl)methyl]-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(O)cc2O)c2cccc(Cl)c2n1 |
| InChI | InChI=1S/C18H15ClN2O3/c1-10-7-14(13-3-2-4-15(19)17(13)21-10)18(24)20-9-11-5-6-12(22)8-16(11)23/h2-8,22-23H,9H2,1H3,(H,20,24) |
| InChIKey | ZIRKWFNCMQRDHV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|