C11H13BrClNOS — CID 103990835
3-bromo-2-chloro-N-(1-methylsulfanylpropan-2-yl)benzamide (PubChem CID 103990835) has the molecular formula C11H13BrClNOS and a molecular weight of 322.66 g/mol. Its IUPAC name is 3-bromo-2-chloro-N-(1-methylsulfanylpropan-2-yl)benzamide.
| Compound Name | 3-bromo-2-chloro-N-(1-methylsulfanylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 103990835 |
| Molecular Formula | C11H13BrClNOS |
| Molecular Weight | 322.66 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 3-bromo-2-chloro-N-(1-methylsulfanylpropan-2-yl)benzamide |
| SMILES | CSCC(C)NC(=O)c1cccc(Br)c1Cl |
| InChI | InChI=1S/C11H13BrClNOS/c1-7(6-16-2)14-11(15)8-4-3-5-9(12)10(8)13/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | GJDRSXNVQLGIMT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |