C25H20Cl2F7N3O2 — CID 10121416
3-(2,5-dichloropyrrol-1-yl)-1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-propan-2-ylbenzene-1,2-dicarboxamide (PubChem CID 10121416) has the molecular formula C25H20Cl2F7N3O2 and a molecular weight of 598.35 g/mol. Its IUPAC name is 3-(2,5-dichloropyrrol-1-yl)-1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-propan-2-ylbenzene-1,2-dicarboxamide.
| Compound Name | 3-(2,5-dichloropyrrol-1-yl)-1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-propan-2-ylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10121416 |
| Molecular Formula | C25H20Cl2F7N3O2 |
| Molecular Weight | 598.35 g/mol |
| Exact Mass | 597.08 |
| IUPAC Name | 3-(2,5-dichloropyrrol-1-yl)-1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2-N-propan-2-ylbenzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(-n2c(Cl)ccc2Cl)c1C(=O)NC(C)C |
| InChI | InChI=1S/C25H20Cl2F7N3O2/c1-12(2)35-22(39)20-15(5-4-6-17(20)37-18(26)9-10-19(37)27)21(38)36-16-8-7-14(11-13(16)3)23(28,24(29,30)31)25(32,33)34/h4-12H,1-3H3,(H,35,39)(H,36,38) |
| InChIKey | YRHGWIWPDGHCAC-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.35 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |