C19H15F7N2O — CID 76846870
N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2,3-dihydro-1H-indole-7-carboxamide (PubChem CID 76846870) has the molecular formula C19H15F7N2O and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2,3-dihydro-1H-indole-7-carboxamide.
| Compound Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2,3-dihydro-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 76846870 |
| Molecular Formula | C19H15F7N2O |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-2,3-dihydro-1H-indole-7-carboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc2c1NCC2 |
| InChI | InChI=1S/C19H15F7N2O/c1-10-9-12(17(20,18(21,22)23)19(24,25)26)5-6-14(10)28-16(29)13-4-2-3-11-7-8-27-15(11)13/h2-6,9,27H,7-8H2,1H3,(H,28,29) |
| InChIKey | KFNFFPNXOGNWRT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |