C24H23F7N2O2 — CID 143193498
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methylcyclobutyl)benzene-1,2-dicarboxamide (PubChem CID 143193498) has the molecular formula C24H23F7N2O2 and a molecular weight of 504.45 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methylcyclobutyl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methylcyclobutyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 143193498 |
| Molecular Formula | C24H23F7N2O2 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methylcyclobutyl)benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(C)c1C(=O)NC1CCC1C |
| InChI | InChI=1S/C24H23F7N2O2/c1-12-7-9-17(12)33-21(35)19-13(2)5-4-6-16(19)20(34)32-18-10-8-15(11-14(18)3)22(25,23(26,27)28)24(29,30)31/h4-6,8,10-12,17H,7,9H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | IOISJGDEXYDJTJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |