C23H22F7N3O4S — CID 143534802
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(methylideneamino)-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 143534802) has the molecular formula C23H22F7N3O4S and a molecular weight of 569.50 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(methylideneamino)-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(methylideneamino)-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 143534802 |
| Molecular Formula | C23H22F7N3O4S |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(methylideneamino)-2-N-(1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | C=Nc1cccc(C(=O)Nc2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2C)c1C(=O)NC(C)CS(C)(=O)=O |
| InChI | InChI=1S/C23H22F7N3O4S/c1-12-10-14(21(24,22(25,26)27)23(28,29)30)8-9-16(12)33-19(34)15-6-5-7-17(31-3)18(15)20(35)32-13(2)11-38(4,36)37/h5-10,13H,3,11H2,1-2,4H3,(H,32,35)(H,33,34) |
| InChIKey | GLBBBMOWFGTABZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|