C21H19F6N3O5 — CID 139981427
1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-3-nitro-2-N-propan-2-ylbenzene-1,2-dicarboxamide (PubChem CID 139981427) has the molecular formula C21H19F6N3O5 and a molecular weight of 507.39 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-3-nitro-2-N-propan-2-ylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-3-nitro-2-N-propan-2-ylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 139981427 |
| Molecular Formula | C21H19F6N3O5 |
| Molecular Weight | 507.39 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 1-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenyl]-3-nitro-2-N-propan-2-ylbenzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc([N+](=O)[O-])c1C(=O)NC(C)C |
| InChI | InChI=1S/C21H19F6N3O5/c1-10(2)28-18(32)16-13(5-4-6-15(16)30(34)35)17(31)29-14-8-7-12(9-11(14)3)19(33,20(22,23)24)21(25,26)27/h4-10,33H,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | KLUYCHBBFKJISJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|