C23H23F7N2O4S — CID 141271628
1-N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 141271628) has the molecular formula C23H23F7N2O4S and a molecular weight of 556.50 g/mol. Its IUPAC name is 1-N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 141271628 |
| Molecular Formula | C23H23F7N2O4S |
| Molecular Weight | 556.50 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1-N-[5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1NC(=O)c1cccc(C(C)(C)CS(C)(=O)=O)c1C(N)=O |
| InChI | InChI=1S/C23H23F7N2O4S/c1-12-8-9-13(21(24,22(25,26)27)23(28,29)30)10-16(12)32-19(34)14-6-5-7-15(17(14)18(31)33)20(2,3)11-37(4,35)36/h5-10H,11H2,1-4H3,(H2,31,33)(H,32,34) |
| InChIKey | QVKHZYMGWQSIJL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |