C22H23F5N2O2S — CID 87460673
3-(2-methyl-1-methylsulfanylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide (PubChem CID 87460673) has the molecular formula C22H23F5N2O2S and a molecular weight of 474.50 g/mol. Its IUPAC name is 3-(2-methyl-1-methylsulfanylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide.
| Compound Name | 3-(2-methyl-1-methylsulfanylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87460673 |
| Molecular Formula | C22H23F5N2O2S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-(2-methyl-1-methylsulfanylpropan-2-yl)-1-N-[2-methyl-4-(1,1,2,2,2-pentafluoroethyl)phenyl]benzene-1,2-dicarboxamide |
| SMILES | CSCC(C)(C)c1cccc(C(=O)Nc2ccc(C(F)(F)C(F)(F)F)cc2C)c1C(N)=O |
| InChI | InChI=1S/C22H23F5N2O2S/c1-12-10-13(21(23,24)22(25,26)27)8-9-16(12)29-19(31)14-6-5-7-15(17(14)18(28)30)20(2,3)11-32-4/h5-10H,11H2,1-4H3,(H2,28,30)(H,29,31) |
| InChIKey | GEUALSLKXJBPTB-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|