C23H24F6N2O2S — CID 10118142
1-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 10118142) has the molecular formula C23H24F6N2O2S and a molecular weight of 506.51 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 10118142 |
| Molecular Formula | C23H24F6N2O2S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 1-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | CSCC(C)(C)NC(=O)c1ccccc1C(=O)Nc1ccc(C(C(F)(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C23H24F6N2O2S/c1-13-11-14(18(22(24,25)26)23(27,28)29)9-10-17(13)30-19(32)15-7-5-6-8-16(15)20(33)31-21(2,3)12-34-4/h5-11,18H,12H2,1-4H3,(H,30,32)(H,31,33) |
| InChIKey | DLUNQMIGFRZCDF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |