C22H23Cl2N3O5S — CID 141384497
1-N-[5-(2,2-dichloroacetyl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)-3-nitrobenzene-1,2-dicarboxamide (PubChem CID 141384497) has the molecular formula C22H23Cl2N3O5S and a molecular weight of 512.42 g/mol. Its IUPAC name is 1-N-[5-(2,2-dichloroacetyl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)-3-nitrobenzene-1,2-dicarboxamide.
| Compound Name | 1-N-[5-(2,2-dichloroacetyl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)-3-nitrobenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 141384497 |
| Molecular Formula | C22H23Cl2N3O5S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 1-N-[5-(2,2-dichloroacetyl)-2-methylphenyl]-2-N-(2-methyl-1-methylsulfanylpropan-2-yl)-3-nitrobenzene-1,2-dicarboxamide |
| SMILES | CSCC(C)(C)NC(=O)c1c(C(=O)Nc2cc(C(=O)C(Cl)Cl)ccc2C)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H23Cl2N3O5S/c1-12-8-9-13(18(28)19(23)24)10-15(12)25-20(29)14-6-5-7-16(27(31)32)17(14)21(30)26-22(2,3)11-33-4/h5-10,19H,11H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | OSTOSLBMSAHIHX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|