C18H18Cl2N2O3 — CID 162663987
1-[4-(4-tert-butylanilino)-3-nitrophenyl]-2,2-dichloroethanone (PubChem CID 162663987) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-[4-(4-tert-butylanilino)-3-nitrophenyl]-2,2-dichloroethanone.
| Compound Name | 1-[4-(4-tert-butylanilino)-3-nitrophenyl]-2,2-dichloroethanone |
|---|---|
| PubChem CID | 162663987 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-[4-(4-tert-butylanilino)-3-nitrophenyl]-2,2-dichloroethanone |
| SMILES | CC(C)(C)c1ccc(Nc2ccc(C(=O)C(Cl)Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H18Cl2N2O3/c1-18(2,3)12-5-7-13(8-6-12)21-14-9-4-11(16(23)17(19)20)10-15(14)22(24)25/h4-10,17,21H,1-3H3 |
| InChIKey | XOVDPDUYPPBDFK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|