C12H16INOS — CID 141307240
2-iodo-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzamide (PubChem CID 141307240) has the molecular formula C12H16INOS and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-iodo-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzamide.
| Compound Name | 2-iodo-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 141307240 |
| Molecular Formula | C12H16INOS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-iodo-N-(2-methyl-1-methylsulfanylpropan-2-yl)benzamide |
| SMILES | CSCC(C)(C)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C12H16INOS/c1-12(2,8-16-3)14-11(15)9-6-4-5-7-10(9)13/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | MZDWZXVBCTUBJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|