C25H27F6IN2O5S — CID 156768978
1-N-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 156768978) has the molecular formula C25H27F6IN2O5S and a molecular weight of 708.46 g/mol. Its IUPAC name is 1-N-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 156768978 |
| Molecular Formula | C25H27F6IN2O5S |
| Molecular Weight | 708.46 g/mol |
| Exact Mass | 708.06 |
| IUPAC Name | 1-N-[4-(2-ethoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)-2-methylphenyl]-3-iodo-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | CCOC(c1ccc(NC(=O)c2cccc(I)c2C(=O)NC(C)(C)CS(C)(=O)=O)c(C)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H27F6IN2O5S/c1-6-39-23(24(26,27)28,25(29,30)31)15-10-11-18(14(2)12-15)33-20(35)16-8-7-9-17(32)19(16)21(36)34-22(3,4)13-40(5,37)38/h7-12H,6,13H2,1-5H3,(H,33,35)(H,34,36) |
| InChIKey | WUWZTPJOKCQXDC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|