C25H26F6INO4S — CID 157130823
2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]acetyl]-6-iodo-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzamide (PubChem CID 157130823) has the molecular formula C25H26F6INO4S and a molecular weight of 677.45 g/mol. Its IUPAC name is 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]acetyl]-6-iodo-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzamide.
| Compound Name | 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]acetyl]-6-iodo-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 157130823 |
| Molecular Formula | C25H26F6INO4S |
| Molecular Weight | 677.45 g/mol |
| Exact Mass | 677.05 |
| IUPAC Name | 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)-2-methylphenyl]acetyl]-6-iodo-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzamide |
| SMILES | Cc1cc(C(C)(C(F)(F)F)C(F)(F)F)ccc1CC(=O)c1cccc(I)c1C(=O)NC(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C25H26F6INO4S/c1-14-11-16(23(4,24(26,27)28)25(29,30)31)10-9-15(14)12-19(34)17-7-6-8-18(32)20(17)21(35)33-22(2,3)13-38(5,36)37/h6-11H,12-13H2,1-5H3,(H,33,35) |
| InChIKey | AJBBENLNQMRBIT-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|