C13H16F3NO3S — CID 99829225
(2R)-2-methylsulfonyl-N-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 99829225) has the molecular formula C13H16F3NO3S and a molecular weight of 323.34 g/mol. Its IUPAC name is (2R)-2-methylsulfonyl-N-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-methylsulfonyl-N-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 99829225 |
| Molecular Formula | C13H16F3NO3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2R)-2-methylsulfonyl-N-[[2-methyl-4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | Cc1cc(C(F)(F)F)ccc1CNC(=O)[C@@H](C)S(C)(=O)=O |
| InChI | InChI=1S/C13H16F3NO3S/c1-8-6-11(13(14,15)16)5-4-10(8)7-17-12(18)9(2)21(3,19)20/h4-6,9H,7H2,1-3H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | SBZMWDZGVAGTHG-SECBINFHSA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |