C23H22F7IN2O4S — CID 53297384
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-iodo-3-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,3-dicarboxamide (PubChem CID 53297384) has the molecular formula C23H22F7IN2O4S and a molecular weight of 682.40 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-iodo-3-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-iodo-3-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 53297384 |
| Molecular Formula | C23H22F7IN2O4S |
| Molecular Weight | 682.40 g/mol |
| Exact Mass | 682.02 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-4-iodo-3-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,3-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1ccc(I)c(C(=O)NC(C)(C)CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H22F7IN2O4S/c1-12-9-14(21(24,22(25,26)27)23(28,29)30)6-8-17(12)32-18(34)13-5-7-16(31)15(10-13)19(35)33-20(2,3)11-38(4,36)37/h5-10H,11H2,1-4H3,(H,32,34)(H,33,35) |
| InChIKey | RKJQJYZYGJTNNB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|