C17H11F7N2O5S — CID 87233835
N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylsulfonylphenyl]-3-nitrobenzamide (PubChem CID 87233835) has the molecular formula C17H11F7N2O5S and a molecular weight of 488.34 g/mol. Its IUPAC name is N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylsulfonylphenyl]-3-nitrobenzamide.
| Compound Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylsulfonylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 87233835 |
| Molecular Formula | C17H11F7N2O5S |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylsulfonylphenyl]-3-nitrobenzamide |
| SMILES | CS(=O)(=O)c1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H11F7N2O5S/c1-32(30,31)13-8-10(15(18,16(19,20)21)17(22,23)24)5-6-12(13)25-14(27)9-3-2-4-11(7-9)26(28)29/h2-8H,1H3,(H,25,27) |
| InChIKey | HMMQDOMIUBXTHH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|