C24H14F7N3O5 — CID 170794775
N-[3-[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazol-2-yl]-4-methoxyphenyl]-3-nitrobenzamide (PubChem CID 170794775) has the molecular formula C24H14F7N3O5 and a molecular weight of 557.38 g/mol. Its IUPAC name is N-[3-[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazol-2-yl]-4-methoxyphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazol-2-yl]-4-methoxyphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 170794775 |
| Molecular Formula | C24H14F7N3O5 |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | N-[3-[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazol-2-yl]-4-methoxyphenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(NC(=O)c2cccc([N+](=O)[O-])c2)cc1-c1nc2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2o1 |
| InChI | InChI=1S/C24H14F7N3O5/c1-38-18-8-6-14(32-20(35)12-3-2-4-15(9-12)34(36)37)11-16(18)21-33-17-7-5-13(10-19(17)39-21)22(25,23(26,27)28)24(29,30)31/h2-11H,1H3,(H,32,35) |
| InChIKey | VZRKKEVQNMRDHZ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|