C21H15F3N2O5 — CID 1341626
N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide (PubChem CID 1341626) has the molecular formula C21H15F3N2O5 and a molecular weight of 432.35 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide.
| Compound Name | N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1341626 |
| Molecular Formula | C21H15F3N2O5 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)-5-(trifluoromethyl)phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H15F3N2O5/c1-30-16-6-8-17(9-7-16)31-19-10-5-14(21(22,23)24)12-18(19)25-20(27)13-3-2-4-15(11-13)26(28)29/h2-12H,1H3,(H,25,27) |
| InChIKey | UHFSSNVGNAZXQJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|