C22H15F3N4O7 — CID 94844855
N-[(Z)-[5-methoxy-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-nitrobenzamide (PubChem CID 94844855) has the molecular formula C22H15F3N4O7 and a molecular weight of 504.38 g/mol. Its IUPAC name is N-[(Z)-[5-methoxy-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-[5-methoxy-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 94844855 |
| Molecular Formula | C22H15F3N4O7 |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[(Z)-[5-methoxy-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]-3-nitrobenzamide |
| SMILES | COc1ccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H15F3N4O7/c1-35-17-6-8-19(36-20-7-5-15(22(23,24)25)11-18(20)29(33)34)14(10-17)12-26-27-21(30)13-3-2-4-16(9-13)28(31)32/h2-12H,1H3,(H,27,30)/b26-12- |
| InChIKey | QOUPHQGFSOXHLG-ZRGSRPPYSA-N |
| XLogP | 5.09 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|