C22H18N2O3 — CID 9325948
3-methoxy-N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]benzamide (PubChem CID 9325948) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-methoxy-N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]benzamide.
| Compound Name | 3-methoxy-N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]benzamide |
|---|---|
| PubChem CID | 9325948 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 3-methoxy-N-[2-(2-methylphenyl)-1,3-benzoxazol-6-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3nc(-c4ccccc4C)oc3c2)c1 |
| InChI | InChI=1S/C22H18N2O3/c1-14-6-3-4-9-18(14)22-24-19-11-10-16(13-20(19)27-22)23-21(25)15-7-5-8-17(12-15)26-2/h3-13H,1-2H3,(H,23,25) |
| InChIKey | WJIKAQZKEBFMGR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |