C10H11NOS — CID 14547561
S-methyl 2,3-dihydro-1H-indole-7-carbothioate (PubChem CID 14547561) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is S-methyl 2,3-dihydro-1H-indole-7-carbothioate.
| Compound Name | S-methyl 2,3-dihydro-1H-indole-7-carbothioate |
|---|---|
| PubChem CID | 14547561 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | S-methyl 2,3-dihydro-1H-indole-7-carbothioate |
| SMILES | CSC(=O)c1cccc2c1NCC2 |
| InChI | InChI=1S/C10H11NOS/c1-13-10(12)8-4-2-3-7-5-6-11-9(7)8/h2-4,11H,5-6H2,1H3 |
| InChIKey | XAEMZAGEPFHTPA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|