S-methyl 2,3-dihydro-1H-indole-7-carbothioate

C10H11NOS — CID 14547561

IUPACS-methyl 2,3-dihydro-1H-indole-7-carbothioate
SMILESCSC(=O)c1cccc2c1NCC2
InChIInChI=1S/C10H11NOS/c1-13-10(12)8-4-2-3-7-5-6-11-9(7)8/h2-4,11H,5-6H2,1H3
InChIKeyXAEMZAGEPFHTPA-UHFFFAOYSA-N
MW193.27 g/mol
LogP2.16
Rot. Bonds1

About S-methyl 2,3-dihydro-1H-indole-7-carbothioate

S-methyl 2,3-dihydro-1H-indole-7-carbothioate (PubChem CID 14547561) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is S-methyl 2,3-dihydro-1H-indole-7-carbothioate.

Molecular Properties

Compound NameS-methyl 2,3-dihydro-1H-indole-7-carbothioate
PubChem CID14547561
Molecular FormulaC10H11NOS
Molecular Weight193.27 g/mol
Exact Mass193.06
IUPAC NameS-methyl 2,3-dihydro-1H-indole-7-carbothioate
SMILESCSC(=O)c1cccc2c1NCC2
InChIInChI=1S/C10H11NOS/c1-13-10(12)8-4-2-3-7-5-6-11-9(7)8/h2-4,11H,5-6H2,1H3
InChIKeyXAEMZAGEPFHTPA-UHFFFAOYSA-N
XLogP2.16
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.27
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze S-methyl 2,3-dihydro-1H-indole-7-carbothioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of S-methyl 2,3-dihydro-1H-indole-7-carbothioate?
The IUPAC name of S-methyl 2,3-dihydro-1H-indole-7-carbothioate (CID 14547561) is S-methyl 2,3-dihydro-1H-indole-7-carbothioate.
What is the SMILES notation for S-methyl 2,3-dihydro-1H-indole-7-carbothioate?
The canonical SMILES for S-methyl 2,3-dihydro-1H-indole-7-carbothioate is CSC(=O)c1cccc2c1NCC2.
What is the InChIKey of S-methyl 2,3-dihydro-1H-indole-7-carbothioate?
The InChIKey is XAEMZAGEPFHTPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-13-10(12)8-4-2-3-7-5-6-11-9(7)8/h2-4,11H,5-6H2,1H3.
What are the key properties of S-methyl 2,3-dihydro-1H-indole-7-carbothioate?
S-methyl 2,3-dihydro-1H-indole-7-carbothioate has a molecular weight of 193.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 2,3-dihydro-1H-indole-7-carbothioate is sourced from PubChem (CID 14547561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).