C9H8F4N2OS — CID 107358720
2-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide (PubChem CID 107358720) has the molecular formula C9H8F4N2OS and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 107358720 |
| Molecular Formula | C9H8F4N2OS |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-fluoro-N-[2-(trifluoromethylsulfanyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)c1cccnc1F |
| InChI | InChI=1S/C9H8F4N2OS/c10-7-6(2-1-3-14-7)8(16)15-4-5-17-9(11,12)13/h1-3H,4-5H2,(H,15,16) |
| InChIKey | UODRCHOGJTVUKZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|