C12H19N3OS — CID 63961240
N-(2-methylsulfanylethyl)-2-(propylamino)pyridine-3-carboxamide (PubChem CID 63961240) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-2-(propylamino)pyridine-3-carboxamide.
| Compound Name | N-(2-methylsulfanylethyl)-2-(propylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63961240 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N-(2-methylsulfanylethyl)-2-(propylamino)pyridine-3-carboxamide |
| SMILES | CCCNc1ncccc1C(=O)NCCSC |
| InChI | InChI=1S/C12H19N3OS/c1-3-6-13-11-10(5-4-7-14-11)12(16)15-8-9-17-2/h4-5,7H,3,6,8-9H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | VHAVAGYVXYUKEA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|