C7H6Cl2N2O — CID 129011418
4,5-dichloro-N-methylpyridine-3-carboxamide (PubChem CID 129011418) has the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. Its IUPAC name is 4,5-dichloro-N-methylpyridine-3-carboxamide.
| Compound Name | 4,5-dichloro-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 129011418 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 4,5-dichloro-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cncc(Cl)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2O/c1-10-7(12)4-2-11-3-5(8)6(4)9/h2-3H,1H3,(H,10,12) |
| InChIKey | XBGNBUGLCGWFRM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |