C7H6ClN3O2 — CID 151323477
4-chloropyridine-3,5-dicarboxamide (PubChem CID 151323477) has the molecular formula C7H6ClN3O2 and a molecular weight of 199.60 g/mol. Its IUPAC name is 4-chloropyridine-3,5-dicarboxamide.
| Compound Name | 4-chloropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 151323477 |
| Molecular Formula | C7H6ClN3O2 |
| Molecular Weight | 199.60 g/mol |
| Exact Mass | 199.01 |
| IUPAC Name | 4-chloropyridine-3,5-dicarboxamide |
| SMILES | NC(=O)c1cncc(C(N)=O)c1Cl |
| InChI | InChI=1S/C7H6ClN3O2/c8-5-3(6(9)12)1-11-2-4(5)7(10)13/h1-2H,(H2,9,12)(H2,10,13) |
| InChIKey | OGYHEZLQVNVGQD-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.60 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |