About 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide
4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide (PubChem CID 123496796) has the molecular formula C7H5ClN4O
and a molecular weight of 196.60 g/mol. Its IUPAC name is 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide |
| PubChem CID | 123496796 |
| Molecular Formula | C7H5ClN4O |
| Molecular Weight | 196.60 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide |
| SMILES | NC(=O)c1cnn2nccc2c1Cl |
| InChI | InChI=1S/C7H5ClN4O/c8-6-4(7(9)13)3-11-12-5(6)1-2-10-12/h1-3H,(H2,9,13) |
| InChIKey | DDUFGBGAQVMZDP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.60 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide?
The IUPAC name of 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide (CID 123496796) is 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide.
What is the SMILES notation for 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide?
The canonical SMILES for 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide is NC(=O)c1cnn2nccc2c1Cl.
What is the InChIKey of 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide?
The InChIKey is DDUFGBGAQVMZDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN4O/c8-6-4(7(9)13)3-11-12-5(6)1-2-10-12/h1-3H,(H2,9,13).
What are the key properties of 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide?
4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide has a molecular weight of 196.60 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrazolo[1,5-b]pyridazine-5-carboxamide is sourced from PubChem (CID 123496796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).