C11H18N2O3S — CID 167190514
tert-butyl N-[(2-methyl-2,3-dihydrothiophene-5-carbonyl)amino]carbamate (PubChem CID 167190514) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is tert-butyl N-[(2-methyl-2,3-dihydrothiophene-5-carbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[(2-methyl-2,3-dihydrothiophene-5-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 167190514 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | tert-butyl N-[(2-methyl-2,3-dihydrothiophene-5-carbonyl)amino]carbamate |
| SMILES | CC1CC=C(C(=O)NNC(=O)OC(C)(C)C)S1 |
| InChI | InChI=1S/C11H18N2O3S/c1-7-5-6-8(17-7)9(14)12-13-10(15)16-11(2,3)4/h6-7H,5H2,1-4H3,(H,12,14)(H,13,15) |
| InChIKey | LAJFRBUBBCDBHZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|