C10H18N2O2S — CID 91484965
tert-butyl N-(3,6-dihydro-2H-thiopyran-4-ylamino)carbamate (PubChem CID 91484965) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is tert-butyl N-(3,6-dihydro-2H-thiopyran-4-ylamino)carbamate.
| Compound Name | tert-butyl N-(3,6-dihydro-2H-thiopyran-4-ylamino)carbamate |
|---|---|
| PubChem CID | 91484965 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | tert-butyl N-(3,6-dihydro-2H-thiopyran-4-ylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1=CCSCC1 |
| InChI | InChI=1S/C10H18N2O2S/c1-10(2,3)14-9(13)12-11-8-4-6-15-7-5-8/h4,11H,5-7H2,1-3H3,(H,12,13) |
| InChIKey | ZNOQURTTXZPGRL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|