C8H5BrO2S2 — CID 133061638
methyl 3-bromothieno[2,3-b]thiophene-5-carboxylate (PubChem CID 133061638) has the molecular formula C8H5BrO2S2 and a molecular weight of 277.16 g/mol. Its IUPAC name is methyl 3-bromothieno[2,3-b]thiophene-5-carboxylate.
| Compound Name | methyl 3-bromothieno[2,3-b]thiophene-5-carboxylate |
|---|---|
| PubChem CID | 133061638 |
| Molecular Formula | C8H5BrO2S2 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 275.89 |
| IUPAC Name | methyl 3-bromothieno[2,3-b]thiophene-5-carboxylate |
| SMILES | COC(=O)c1cc2c(Br)csc2s1 |
| InChI | InChI=1S/C8H5BrO2S2/c1-11-7(10)6-2-4-5(9)3-12-8(4)13-6/h2-3H,1H3 |
| InChIKey | AEKHKEVGGFCTEZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |