C8H4Br2O2SSe — CID 70874095
methyl 4,6-dibromoselenopheno[3,4-b]thiophene-2-carboxylate (PubChem CID 70874095) has the molecular formula C8H4Br2O2SSe and a molecular weight of 402.95 g/mol. Its IUPAC name is methyl 4,6-dibromoselenopheno[3,4-b]thiophene-2-carboxylate.
| Compound Name | methyl 4,6-dibromoselenopheno[3,4-b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70874095 |
| Molecular Formula | C8H4Br2O2SSe |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 401.75 |
| IUPAC Name | methyl 4,6-dibromoselenopheno[3,4-b]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(Br)[se]c(Br)c2s1 |
| InChI | InChI=1S/C8H4Br2O2SSe/c1-12-8(11)4-2-3-5(13-4)7(10)14-6(3)9/h2H,1H3 |
| InChIKey | RHDXATRGPJYBKT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|