C7H7N3O2S — CID 44558323
methyl 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylate (PubChem CID 44558323) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is methyl 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylate.
| Compound Name | methyl 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 44558323 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | methyl 3-amino-1H-thieno[3,2-c]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1cc2[nH]nc(N)c2s1 |
| InChI | InChI=1S/C7H7N3O2S/c1-12-7(11)4-2-3-5(13-4)6(8)10-9-3/h2H,1H3,(H3,8,9,10) |
| InChIKey | BZTKCTZKSHFJDY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |