About propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate
propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate (PubChem CID 133059840) has the molecular formula C11H11NO3S2
and a molecular weight of 269.35 g/mol. Its IUPAC name is propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
| PubChem CID | 133059840 |
| Molecular Formula | C11H11NO3S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate |
| SMILES | CC(C)OC(=O)c1cc2cc(C(N)=O)sc2s1 |
| InChI | InChI=1S/C11H11NO3S2/c1-5(2)15-10(14)8-4-6-3-7(9(12)13)16-11(6)17-8/h3-5H,1-2H3,(H2,12,13) |
| InChIKey | VJXDVLCLNPKXEV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate?
The IUPAC name of propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate (CID 133059840) is propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate.
What is the SMILES notation for propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate?
The canonical SMILES for propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate is CC(C)OC(=O)c1cc2cc(C(N)=O)sc2s1.
What is the InChIKey of propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate?
The InChIKey is VJXDVLCLNPKXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S2/c1-5(2)15-10(14)8-4-6-3-7(9(12)13)16-11(6)17-8/h3-5H,1-2H3,(H2,12,13).
What are the key properties of propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate?
propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate has a molecular weight of 269.35 g/mol, XLogP of 2.63, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-carbamoylthieno[2,3-b]thiophene-5-carboxylate is sourced from PubChem (CID 133059840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).