C7H7NO6S2 — CID 139663921
5-methoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid (PubChem CID 139663921) has the molecular formula C7H7NO6S2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 5-methoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid.
| Compound Name | 5-methoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 139663921 |
| Molecular Formula | C7H7NO6S2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 5-methoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid |
| SMILES | COC(=O)c1sc(C(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H7NO6S2/c1-14-7(11)5-4(16(8,12)13)2-3(15-5)6(9)10/h2H,1H3,(H,9,10)(H2,8,12,13) |
| InChIKey | HGNGNUIGTASVHF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |