C10H12O7S2 — CID 139663947
2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid (PubChem CID 139663947) has the molecular formula C10H12O7S2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid.
| Compound Name | 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid |
|---|---|
| PubChem CID | 139663947 |
| Molecular Formula | C10H12O7S2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)O)c(C(=O)OCC)s1 |
| InChI | InChI=1S/C10H12O7S2/c1-3-16-9(11)6-5-7(19(13,14)15)8(18-6)10(12)17-4-2/h5H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | CAGYNRXDFQSQQV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|