2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid

C10H12O7S2 — CID 139663947

IUPAC2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid
SMILESCCOC(=O)c1cc(S(=O)(=O)O)c(C(=O)OCC)s1
InChIInChI=1S/C10H12O7S2/c1-3-16-9(11)6-5-7(19(13,14)15)8(18-6)10(12)17-4-2/h5H,3-4H2,1-2H3,(H,13,14,15)
InChIKeyCAGYNRXDFQSQQV-UHFFFAOYSA-N
MW308.33 g/mol
LogP1.35
Rot. Bonds5

About 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid

2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid (PubChem CID 139663947) has the molecular formula C10H12O7S2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid.

Molecular Properties

Compound Name2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid
PubChem CID139663947
Molecular FormulaC10H12O7S2
Molecular Weight308.33 g/mol
Exact Mass308.00
IUPAC Name2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid
SMILESCCOC(=O)c1cc(S(=O)(=O)O)c(C(=O)OCC)s1
InChIInChI=1S/C10H12O7S2/c1-3-16-9(11)6-5-7(19(13,14)15)8(18-6)10(12)17-4-2/h5H,3-4H2,1-2H3,(H,13,14,15)
InChIKeyCAGYNRXDFQSQQV-UHFFFAOYSA-N
XLogP1.35
TPSA106.97 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.33
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid?
The IUPAC name of 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid (CID 139663947) is 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid.
What is the SMILES notation for 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid?
The canonical SMILES for 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid is CCOC(=O)c1cc(S(=O)(=O)O)c(C(=O)OCC)s1.
What is the InChIKey of 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid?
The InChIKey is CAGYNRXDFQSQQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O7S2/c1-3-16-9(11)6-5-7(19(13,14)15)8(18-6)10(12)17-4-2/h5H,3-4H2,1-2H3,(H,13,14,15).
What are the key properties of 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid?
2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid has a molecular weight of 308.33 g/mol, XLogP of 1.35, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(ethoxycarbonyl)thiophene-3-sulfonic acid is sourced from PubChem (CID 139663947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).