C8H9NO6S2 — CID 139663926
5-ethoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid (PubChem CID 139663926) has the molecular formula C8H9NO6S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-ethoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid.
| Compound Name | 5-ethoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 139663926 |
| Molecular Formula | C8H9NO6S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | 5-ethoxycarbonyl-4-sulfamoylthiophene-2-carboxylic acid |
| SMILES | CCOC(=O)c1sc(C(=O)O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H9NO6S2/c1-2-15-8(12)6-5(17(9,13)14)3-4(16-6)7(10)11/h3H,2H2,1H3,(H,10,11)(H2,9,13,14) |
| InChIKey | PCKBJRAIOKMLAY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |