C9H13NO5S2 — CID 112689917
2-methoxyethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate (PubChem CID 112689917) has the molecular formula C9H13NO5S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-methoxyethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate.
| Compound Name | 2-methoxyethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 112689917 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 2-methoxyethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate |
| SMILES | COCCOC(=O)c1cc(S(N)(=O)=O)c(C)s1 |
| InChI | InChI=1S/C9H13NO5S2/c1-6-8(17(10,12)13)5-7(16-6)9(11)15-4-3-14-2/h5H,3-4H2,1-2H3,(H2,10,12,13) |
| InChIKey | UJPMGWPMDCIQRN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|