C12H19NO5S2 — CID 115615927
2-[(2-methylpropan-2-yl)oxy]ethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate (PubChem CID 115615927) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]ethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 115615927 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 5-methyl-4-sulfamoylthiophene-2-carboxylate |
| SMILES | Cc1sc(C(=O)OCCOC(C)(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H19NO5S2/c1-8-10(20(13,15)16)7-9(19-8)11(14)17-5-6-18-12(2,3)4/h7H,5-6H2,1-4H3,(H2,13,15,16) |
| InChIKey | BSWGYWWFTVTZIM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|