C10H13NO6S2 — CID 63328909
4-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-5-methylthiophene-2-carboxylic acid (PubChem CID 63328909) has the molecular formula C10H13NO6S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-5-methylthiophene-2-carboxylic acid.
| Compound Name | 4-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-5-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63328909 |
| Molecular Formula | C10H13NO6S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-[[(2S)-1-methoxy-1-oxopropan-2-yl]sulfamoyl]-5-methylthiophene-2-carboxylic acid |
| SMILES | COC(=O)[C@H](C)NS(=O)(=O)c1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C10H13NO6S2/c1-5(10(14)17-3)11-19(15,16)8-4-7(9(12)13)18-6(8)2/h4-5,11H,1-3H3,(H,12,13)/t5-/m0/s1 |
| InChIKey | DIGCUHBOQSPAED-YFKPBYRVSA-N |
| XLogP | 0.59 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |