C8H6OS2 — CID 15698036
1-thieno[2,3-b]thiophen-5-ylethanone (PubChem CID 15698036) has the molecular formula C8H6OS2 and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-thieno[2,3-b]thiophen-5-ylethanone.
| Compound Name | 1-thieno[2,3-b]thiophen-5-ylethanone |
|---|---|
| PubChem CID | 15698036 |
| Molecular Formula | C8H6OS2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 181.99 |
| IUPAC Name | 1-thieno[2,3-b]thiophen-5-ylethanone |
| SMILES | CC(=O)c1cc2ccsc2s1 |
| InChI | InChI=1S/C8H6OS2/c1-5(9)7-4-6-2-3-10-8(6)11-7/h2-4H,1H3 |
| InChIKey | GICOZXMGGYEODH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |