C8H5NO3S2 — CID 90847279
2-hydroxyimino-2-thieno[2,3-b]thiophen-5-ylacetic acid (PubChem CID 90847279) has the molecular formula C8H5NO3S2 and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-hydroxyimino-2-thieno[2,3-b]thiophen-5-ylacetic acid.
| Compound Name | 2-hydroxyimino-2-thieno[2,3-b]thiophen-5-ylacetic acid |
|---|---|
| PubChem CID | 90847279 |
| Molecular Formula | C8H5NO3S2 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 2-hydroxyimino-2-thieno[2,3-b]thiophen-5-ylacetic acid |
| SMILES | O=C(O)C(=NO)c1cc2ccsc2s1 |
| InChI | InChI=1S/C8H5NO3S2/c10-7(11)6(9-12)5-3-4-1-2-13-8(4)14-5/h1-3,12H,(H,10,11) |
| InChIKey | OSQJMUIOAVWNDI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|