C13H6OS4 — CID 70589799
bis(thieno[2,3-b]thiophen-5-yl)methanone (PubChem CID 70589799) has the molecular formula C13H6OS4 and a molecular weight of 306.46 g/mol. Its IUPAC name is bis(thieno[2,3-b]thiophen-5-yl)methanone.
| Compound Name | bis(thieno[2,3-b]thiophen-5-yl)methanone |
|---|---|
| PubChem CID | 70589799 |
| Molecular Formula | C13H6OS4 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | bis(thieno[2,3-b]thiophen-5-yl)methanone |
| SMILES | O=C(c1cc2ccsc2s1)c1cc2ccsc2s1 |
| InChI | InChI=1S/C13H6OS4/c14-11(9-5-7-1-3-15-12(7)17-9)10-6-8-2-4-16-13(8)18-10/h1-6H |
| InChIKey | OXRXYBWGXPYFQW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |