C15H13NO2S — CID 778240
ethyl 7-methylthieno[2,3-b]quinoline-2-carboxylate (PubChem CID 778240) has the molecular formula C15H13NO2S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 7-methylthieno[2,3-b]quinoline-2-carboxylate.
| Compound Name | ethyl 7-methylthieno[2,3-b]quinoline-2-carboxylate |
|---|---|
| PubChem CID | 778240 |
| Molecular Formula | C15H13NO2S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 7-methylthieno[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc3ccc(C)cc3nc2s1 |
| InChI | InChI=1S/C15H13NO2S/c1-3-18-15(17)13-8-11-7-10-5-4-9(2)6-12(10)16-14(11)19-13/h4-8H,3H2,1-2H3 |
| InChIKey | XOYXTXUNBHZUBL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |