C17H18N2O2S — CID 22434505
N-(3-methoxypropyl)-7-methylthieno[2,3-b]quinoline-2-carboxamide (PubChem CID 22434505) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-(3-methoxypropyl)-7-methylthieno[2,3-b]quinoline-2-carboxamide.
| Compound Name | N-(3-methoxypropyl)-7-methylthieno[2,3-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 22434505 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-(3-methoxypropyl)-7-methylthieno[2,3-b]quinoline-2-carboxamide |
| SMILES | COCCCNC(=O)c1cc2cc3ccc(C)cc3nc2s1 |
| InChI | InChI=1S/C17H18N2O2S/c1-11-4-5-12-9-13-10-15(16(20)18-6-3-7-21-2)22-17(13)19-14(12)8-11/h4-5,8-10H,3,6-7H2,1-2H3,(H,18,20) |
| InChIKey | JZRQITMPFVHTEC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|