C15H18N2O2 — CID 78870006
N-(3-hydroxypropyl)-2,7-dimethylquinoline-3-carboxamide (PubChem CID 78870006) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2,7-dimethylquinoline-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-2,7-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 78870006 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-(3-hydroxypropyl)-2,7-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCCCO)c(C)nc2c1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-4-5-12-9-13(11(2)17-14(12)8-10)15(19)16-6-3-7-18/h4-5,8-9,18H,3,6-7H2,1-2H3,(H,16,19) |
| InChIKey | GZMMNEXXDSAIFM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|