C23H26N2O3 — CID 55868189
7-methoxy-2-methyl-N-[4-(4-methylphenoxy)butyl]quinoline-3-carboxamide (PubChem CID 55868189) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 7-methoxy-2-methyl-N-[4-(4-methylphenoxy)butyl]quinoline-3-carboxamide.
| Compound Name | 7-methoxy-2-methyl-N-[4-(4-methylphenoxy)butyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 55868189 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 7-methoxy-2-methyl-N-[4-(4-methylphenoxy)butyl]quinoline-3-carboxamide |
| SMILES | COc1ccc2cc(C(=O)NCCCCOc3ccc(C)cc3)c(C)nc2c1 |
| InChI | InChI=1S/C23H26N2O3/c1-16-6-9-19(10-7-16)28-13-5-4-12-24-23(26)21-14-18-8-11-20(27-3)15-22(18)25-17(21)2/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,24,26) |
| InChIKey | XXYSGEJTHOGFBX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|