C16H19N3O2 — CID 56812703
N-(4-amino-4-oxobutyl)-2,7-dimethylquinoline-3-carboxamide (PubChem CID 56812703) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-2,7-dimethylquinoline-3-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-2,7-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 56812703 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-2,7-dimethylquinoline-3-carboxamide |
| SMILES | Cc1ccc2cc(C(=O)NCCCC(N)=O)c(C)nc2c1 |
| InChI | InChI=1S/C16H19N3O2/c1-10-5-6-12-9-13(11(2)19-14(12)8-10)16(21)18-7-3-4-15(17)20/h5-6,8-9H,3-4,7H2,1-2H3,(H2,17,20)(H,18,21) |
| InChIKey | NBXIAQJTKWTGLX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|